About 3-(1,2,4-triazol-4-yl)piperidine
3-(1,2,4-triazol-4-yl)piperidine (PubChem CID 63318957) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 3-(1,2,4-triazol-4-yl)piperidine.
Molecular Properties
| Compound Name | 3-(1,2,4-triazol-4-yl)piperidine |
| PubChem CID | 63318957 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 3-(1,2,4-triazol-4-yl)piperidine |
| SMILES | c1nncn1C1CCCNC1 |
| InChI | InChI=1S/C7H12N4/c1-2-7(4-8-3-1)11-5-9-10-6-11/h5-8H,1-4H2 |
| InChIKey | PSZLCXKDXBQGGD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,2,4-triazol-4-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-triazol-4-yl)piperidine?
The IUPAC name of 3-(1,2,4-triazol-4-yl)piperidine (CID 63318957) is 3-(1,2,4-triazol-4-yl)piperidine.
What is the SMILES notation for 3-(1,2,4-triazol-4-yl)piperidine?
The canonical SMILES for 3-(1,2,4-triazol-4-yl)piperidine is c1nncn1C1CCCNC1.
What is the InChIKey of 3-(1,2,4-triazol-4-yl)piperidine?
The InChIKey is PSZLCXKDXBQGGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-2-7(4-8-3-1)11-5-9-10-6-11/h5-8H,1-4H2.
What are the key properties of 3-(1,2,4-triazol-4-yl)piperidine?
3-(1,2,4-triazol-4-yl)piperidine has a molecular weight of 152.20 g/mol, XLogP of 0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-triazol-4-yl)piperidine is sourced from PubChem (CID 63318957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).