C12H13F3O4 — CID 63320571
4-(2-hydroxybutoxy)-3-(trifluoromethyl)benzoic acid (PubChem CID 63320571) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 4-(2-hydroxybutoxy)-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(2-hydroxybutoxy)-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 63320571 |
| Molecular Formula | C12H13F3O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-(2-hydroxybutoxy)-3-(trifluoromethyl)benzoic acid |
| SMILES | CCC(O)COc1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C12H13F3O4/c1-2-8(16)6-19-10-4-3-7(11(17)18)5-9(10)12(13,14)15/h3-5,8,16H,2,6H2,1H3,(H,17,18) |
| InChIKey | LVEJBLBTWNBRST-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |