C14H13BrF3NOS — CID 63320770
2-[4-[(5-bromothiophen-2-yl)methoxy]-3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 63320770) has the molecular formula C14H13BrF3NOS and a molecular weight of 380.23 g/mol. Its IUPAC name is 2-[4-[(5-bromothiophen-2-yl)methoxy]-3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-[4-[(5-bromothiophen-2-yl)methoxy]-3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 63320770 |
| Molecular Formula | C14H13BrF3NOS |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 2-[4-[(5-bromothiophen-2-yl)methoxy]-3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | NCCc1ccc(OCc2ccc(Br)s2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H13BrF3NOS/c15-13-4-2-10(21-13)8-20-12-3-1-9(5-6-19)7-11(12)14(16,17)18/h1-4,7H,5-6,8,19H2 |
| InChIKey | SSYTUNAYXCCXDB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |