About [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium
[2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium (PubChem CID 6332364) has the molecular formula C5H7N4O+
and a molecular weight of 139.14 g/mol. Its IUPAC name is [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium.
Molecular Properties
| Compound Name | [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium |
| PubChem CID | 6332364 |
| Molecular Formula | C5H7N4O+ |
| Molecular Weight | 139.14 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium |
| SMILES | N=[N+]=CC(=O)C1CCN=N1 |
| InChI | InChI=1S/C5H7N4O/c6-7-3-5(10)4-1-2-8-9-4/h3-4,6H,1-2H2/q+1 |
| InChIKey | DTDFLYSALIRSGZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.14 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium?
The IUPAC name of [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium (CID 6332364) is [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium.
What is the SMILES notation for [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium?
The canonical SMILES for [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium is N=[N+]=CC(=O)C1CCN=N1.
What is the InChIKey of [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium?
The InChIKey is DTDFLYSALIRSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N4O/c6-7-3-5(10)4-1-2-8-9-4/h3-4,6H,1-2H2/q+1.
What are the key properties of [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium?
[2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium has a molecular weight of 139.14 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,5-dihydro-3H-pyrazol-3-yl)-2-oxoethylidene]-iminoazanium is sourced from PubChem (CID 6332364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).