About [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium
[1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium (PubChem CID 6332472) has the molecular formula C12H9N2O6+
and a molecular weight of 277.21 g/mol. Its IUPAC name is [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium.
Molecular Properties
| Compound Name | [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium |
| PubChem CID | 6332472 |
| Molecular Formula | C12H9N2O6+ |
| Molecular Weight | 277.21 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium |
| SMILES | CCOC(=O)C(=[N+]=N)C(=O)c1ccc2oc(=O)oc2c1 |
| InChI | InChI=1S/C12H9N2O6/c1-2-18-11(16)9(14-13)10(15)6-3-4-7-8(5-6)20-12(17)19-7/h3-5,13H,2H2,1H3/q+1 |
| InChIKey | MKVICBHUBPCYOL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium?
The IUPAC name of [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium (CID 6332472) is [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium.
What is the SMILES notation for [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium?
The canonical SMILES for [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium is CCOC(=O)C(=[N+]=N)C(=O)c1ccc2oc(=O)oc2c1.
What is the InChIKey of [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium?
The InChIKey is MKVICBHUBPCYOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N2O6/c1-2-18-11(16)9(14-13)10(15)6-3-4-7-8(5-6)20-12(17)19-7/h3-5,13H,2H2,1H3/q+1.
What are the key properties of [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium?
[1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium has a molecular weight of 277.21 g/mol, XLogP of 0.81, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-ethoxy-1,3-dioxo-3-(2-oxo-1,3-benzodioxol-5-yl)propan-2-ylidene]-iminoazanium is sourced from PubChem (CID 6332472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).