About cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium
cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium (PubChem CID 6332621) has the molecular formula C23H17CoI2P-4
and a molecular weight of 637.10 g/mol. Its IUPAC name is cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium |
| PubChem CID | 6332621 |
| Molecular Formula | C23H17CoI2P-4 |
| Molecular Weight | 637.10 g/mol |
| Exact Mass | 636.85 |
| IUPAC Name | cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium |
| SMILES | I[Co]I.[c-]1[c-][c-][cH-][c-]1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C5H.Co.2HI/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-5-3-1;;;/h1-15H;1H;;2*1H/q;-5;+2;;/p-1 |
| InChIKey | FQJKGHJRFKHHOK-UHFFFAOYSA-M |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.10 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium?
The IUPAC name of cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium (CID 6332621) is cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium.
What is the SMILES notation for cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium?
The canonical SMILES for cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium is I[Co]I.[c-]1[c-][c-][cH-][c-]1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium?
The InChIKey is FQJKGHJRFKHHOK-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.C5H.Co.2HI/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-5-3-1;;;/h1-15H;1H;;2*1H/q;-5;+2;;/p-1.
What are the key properties of cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium?
cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium has a molecular weight of 637.10 g/mol, XLogP of 5.55, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;diiodocobalt;triphenylphosphanium is sourced from PubChem (CID 6332621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).