C11H13N3O — CID 63326553
4-methyl-2-[(1H-pyrazol-4-ylamino)methyl]phenol (PubChem CID 63326553) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-methyl-2-[(1H-pyrazol-4-ylamino)methyl]phenol.
| Compound Name | 4-methyl-2-[(1H-pyrazol-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 63326553 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-methyl-2-[(1H-pyrazol-4-ylamino)methyl]phenol |
| SMILES | Cc1ccc(O)c(CNc2cn[nH]c2)c1 |
| InChI | InChI=1S/C11H13N3O/c1-8-2-3-11(15)9(4-8)5-12-10-6-13-14-7-10/h2-4,6-7,12,15H,5H2,1H3,(H,13,14) |
| InChIKey | HISLWEYITJMGBW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|