About 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide
6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 63327463) has the molecular formula C11H12N6O2S2
and a molecular weight of 324.39 g/mol. Its IUPAC name is 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| PubChem CID | 63327463 |
| Molecular Formula | C11H12N6O2S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | Cc1ccncc1NS(=O)(=O)c1c(NN)nc2sccn12 |
| InChI | InChI=1S/C11H12N6O2S2/c1-7-2-3-13-6-8(7)16-21(18,19)10-9(15-12)14-11-17(10)4-5-20-11/h2-6,15-16H,12H2,1H3 |
| InChIKey | BVVUSKFJXBZCKR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The IUPAC name of 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (CID 63327463) is 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
What is the SMILES notation for 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The canonical SMILES for 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide is Cc1ccncc1NS(=O)(=O)c1c(NN)nc2sccn12.
What is the InChIKey of 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The InChIKey is BVVUSKFJXBZCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N6O2S2/c1-7-2-3-13-6-8(7)16-21(18,19)10-9(15-12)14-11-17(10)4-5-20-11/h2-6,15-16H,12H2,1H3.
What are the key properties of 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide?
6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide has a molecular weight of 324.39 g/mol, XLogP of 1.19, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydrazinyl-N-(4-methyl-3-pyridinyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide is sourced from PubChem (CID 63327463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).