About dichloronickel;bis(triphenylphosphanium)
dichloronickel;bis(triphenylphosphanium) (PubChem CID 6332751) has the molecular formula C36H32Cl2NiP2+2
and a molecular weight of 656.20 g/mol. Its IUPAC name is dichloronickel;bis(triphenylphosphanium).
Molecular Properties
| Compound Name | dichloronickel;bis(triphenylphosphanium) |
| PubChem CID | 6332751 |
| Molecular Formula | C36H32Cl2NiP2+2 |
| Molecular Weight | 656.20 g/mol |
| Exact Mass | 654.07 |
| IUPAC Name | dichloronickel;bis(triphenylphosphanium) |
| SMILES | Cl[Ni]Cl.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2 |
| InChIKey | ZBRJXVVKPBZPAN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.20 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel;bis(triphenylphosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel;bis(triphenylphosphanium)?
The IUPAC name of dichloronickel;bis(triphenylphosphanium) (CID 6332751) is dichloronickel;bis(triphenylphosphanium).
What is the SMILES notation for dichloronickel;bis(triphenylphosphanium)?
The canonical SMILES for dichloronickel;bis(triphenylphosphanium) is Cl[Ni]Cl.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dichloronickel;bis(triphenylphosphanium)?
The InChIKey is ZBRJXVVKPBZPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H15P.2ClH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2.
What are the key properties of dichloronickel;bis(triphenylphosphanium)?
dichloronickel;bis(triphenylphosphanium) has a molecular weight of 656.20 g/mol, XLogP of 7.73, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel;bis(triphenylphosphanium) is sourced from PubChem (CID 6332751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).