C7H17N5O3+2 — CID 6332757
dihydroxy(oxo)azanium;1-methyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane (PubChem CID 6332757) has the molecular formula C7H17N5O3+2 and a molecular weight of 219.24 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;1-methyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane.
| Compound Name | dihydroxy(oxo)azanium;1-methyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6332757 |
| Molecular Formula | C7H17N5O3+2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | dihydroxy(oxo)azanium;1-methyl-3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decane |
| SMILES | C[N+]12CN3CN(CN(C3)C1)C2.O=[N+](O)O |
| InChI | InChI=1S/C7H15N4.H2NO3/c1-11-5-8-2-9(6-11)4-10(3-8)7-11;2-1(3)4/h2-7H2,1H3;(H2,2,3,4)/q2*+1 |
| InChIKey | AVONMYAVPGYYGM-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|