About 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione
3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione (PubChem CID 63327823) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione |
| PubChem CID | 63327823 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2cnccc2C)C1=O |
| InChI | InChI=1S/C11H10N2O2/c1-7-3-4-12-6-9(7)13-10(14)5-8(2)11(13)15/h3-6H,1-2H3 |
| InChIKey | CXGPJEIUTHSDNU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione?
The IUPAC name of 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione (CID 63327823) is 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione.
What is the SMILES notation for 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione?
The canonical SMILES for 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione is CC1=CC(=O)N(c2cnccc2C)C1=O.
What is the InChIKey of 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione?
The InChIKey is CXGPJEIUTHSDNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-7-3-4-12-6-9(7)13-10(14)5-8(2)11(13)15/h3-6H,1-2H3.
What are the key properties of 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione?
3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione has a molecular weight of 202.21 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(4-methyl-3-pyridinyl)pyrrole-2,5-dione is sourced from PubChem (CID 63327823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).