C9H10N4O2 — CID 63330089
1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione (PubChem CID 63330089) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 63330089 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]pyrrole-2,5-dione |
| SMILES | Cn1cnnc1CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H10N4O2/c1-12-6-10-11-7(12)4-5-13-8(14)2-3-9(13)15/h2-3,6H,4-5H2,1H3 |
| InChIKey | IMSPCMJGUSHUKP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|