C13H13N5O2 — CID 63330270
5-amino-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 63330270) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 5-amino-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 5-amino-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 63330270 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5-amino-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | Cn1cnnc1CCN1C(=O)c2ccc(N)cc2C1=O |
| InChI | InChI=1S/C13H13N5O2/c1-17-7-15-16-11(17)4-5-18-12(19)9-3-2-8(14)6-10(9)13(18)20/h2-3,6-7H,4-5,14H2,1H3 |
| InChIKey | RTOTWBZJXFFHCN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|