C11H11N5OS2 — CID 63330332
3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 63330332) has the molecular formula C11H11N5OS2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 63330332 |
| Molecular Formula | C11H11N5OS2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cn1cnnc1CCn1c(=S)[nH]c2ccsc2c1=O |
| InChI | InChI=1S/C11H11N5OS2/c1-15-6-12-14-8(15)2-4-16-10(17)9-7(3-5-19-9)13-11(16)18/h3,5-6H,2,4H2,1H3,(H,13,18) |
| InChIKey | ZFSZZSZQHZRBOT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|