About 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid
4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid (PubChem CID 63330905) has the molecular formula C13H23N5O3
and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid.
Molecular Properties
| Compound Name | 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid |
| PubChem CID | 63330905 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)C(=O)NCCc1nncn1C |
| InChI | InChI=1S/C13H23N5O3/c1-10(2)18(8-4-5-12(19)20)13(21)14-7-6-11-16-15-9-17(11)3/h9-10H,4-8H2,1-3H3,(H,14,21)(H,19,20) |
| InChIKey | MZIRICHVBCSQLL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid?
The IUPAC name of 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid (CID 63330905) is 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid.
What is the SMILES notation for 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid?
The canonical SMILES for 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid is CC(C)N(CCCC(=O)O)C(=O)NCCc1nncn1C.
What is the InChIKey of 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid?
The InChIKey is MZIRICHVBCSQLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N5O3/c1-10(2)18(8-4-5-12(19)20)13(21)14-7-6-11-16-15-9-17(11)3/h9-10H,4-8H2,1-3H3,(H,14,21)(H,19,20).
What are the key properties of 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid?
4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid has a molecular weight of 297.36 g/mol, XLogP of 0.64, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-methyl-1,2,4-triazol-3-yl)ethylcarbamoyl-propan-2-ylamino]butanoic acid is sourced from PubChem (CID 63330905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).