About 3-benzyloxolan-3-ol
3-benzyloxolan-3-ol (PubChem CID 63332039) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-benzyloxolan-3-ol.
Molecular Properties
| Compound Name | 3-benzyloxolan-3-ol |
| PubChem CID | 63332039 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 3-benzyloxolan-3-ol |
| SMILES | OC1(Cc2ccccc2)CCOC1 |
| InChI | InChI=1S/C11H14O2/c12-11(6-7-13-9-11)8-10-4-2-1-3-5-10/h1-5,12H,6-9H2 |
| InChIKey | CWRPWMAOPSGTQU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyloxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyloxolan-3-ol?
The IUPAC name of 3-benzyloxolan-3-ol (CID 63332039) is 3-benzyloxolan-3-ol.
What is the SMILES notation for 3-benzyloxolan-3-ol?
The canonical SMILES for 3-benzyloxolan-3-ol is OC1(Cc2ccccc2)CCOC1.
What is the InChIKey of 3-benzyloxolan-3-ol?
The InChIKey is CWRPWMAOPSGTQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c12-11(6-7-13-9-11)8-10-4-2-1-3-5-10/h1-5,12H,6-9H2.
What are the key properties of 3-benzyloxolan-3-ol?
3-benzyloxolan-3-ol has a molecular weight of 178.23 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyloxolan-3-ol is sourced from PubChem (CID 63332039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).