C12H18N6O2 — CID 63332256
1,3-dimethyl-6-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]pyrimidine-2,4-dione (PubChem CID 63332256) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is 1,3-dimethyl-6-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63332256 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1,3-dimethyl-6-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]pyrimidine-2,4-dione |
| SMILES | Cn1cnnc1CCNCc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C12H18N6O2/c1-16-8-14-15-10(16)4-5-13-7-9-6-11(19)18(3)12(20)17(9)2/h6,8,13H,4-5,7H2,1-3H3 |
| InChIKey | PJFCCFQDUMGHFZ-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|