C14H17N7 — CID 63332274
2-(4-methyl-1,2,4-triazol-3-yl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]ethanamine (PubChem CID 63332274) has the molecular formula C14H17N7 and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-(4-methyl-1,2,4-triazol-3-yl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]ethanamine.
| Compound Name | 2-(4-methyl-1,2,4-triazol-3-yl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 63332274 |
| Molecular Formula | C14H17N7 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-(4-methyl-1,2,4-triazol-3-yl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]ethanamine |
| SMILES | Cn1cnnc1CCNCc1cn[nH]c1-c1cccnc1 |
| InChI | InChI=1S/C14H17N7/c1-21-10-18-19-13(21)4-6-16-8-12-9-17-20-14(12)11-3-2-5-15-7-11/h2-3,5,7,9-10,16H,4,6,8H2,1H3,(H,17,20) |
| InChIKey | ZRJAPGHWYNGEQR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|