C9H19N5 — CID 63332293
N',N'-dimethyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]ethane-1,2-diamine (PubChem CID 63332293) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 63332293 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | N',N'-dimethyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCCc1nncn1C |
| InChI | InChI=1S/C9H19N5/c1-13(2)7-6-10-5-4-9-12-11-8-14(9)3/h8,10H,4-7H2,1-3H3 |
| InChIKey | JLIMVBNMVBOESX-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|