C12H14F2N4 — CID 63332710
N-[(2,5-difluorophenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 63332710) has the molecular formula C12H14F2N4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 63332710 |
| Molecular Formula | C12H14F2N4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | Cn1cnnc1CCNCc1cc(F)ccc1F |
| InChI | InChI=1S/C12H14F2N4/c1-18-8-16-17-12(18)4-5-15-7-9-6-10(13)2-3-11(9)14/h2-3,6,8,15H,4-5,7H2,1H3 |
| InChIKey | GUOOFBAFEUBQQG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|