About imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium
imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium (PubChem CID 6333298) has the molecular formula C3H5N6O+
and a molecular weight of 141.11 g/mol. Its IUPAC name is imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium.
Molecular Properties
| Compound Name | imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium |
| PubChem CID | 6333298 |
| Molecular Formula | C3H5N6O+ |
| Molecular Weight | 141.11 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium |
| SMILES | COc1n[nH]c(N=[N+]=N)n1 |
| InChI | InChI=1S/C3H4N6O/c1-10-3-5-2(6-8-3)7-9-4/h4H,1H3/p+1 |
| InChIKey | MFRRZOVMIKYYME-UHFFFAOYSA-O |
| XLogP | -0.00 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.11 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium?
The IUPAC name of imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium (CID 6333298) is imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium.
What is the SMILES notation for imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium?
The canonical SMILES for imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium is COc1n[nH]c(N=[N+]=N)n1.
What is the InChIKey of imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium?
The InChIKey is MFRRZOVMIKYYME-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H4N6O/c1-10-3-5-2(6-8-3)7-9-4/h4H,1H3/p+1.
What are the key properties of imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium?
imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium has a molecular weight of 141.11 g/mol, XLogP of -0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imino-[(3-methoxy-1H-1,2,4-triazol-5-yl)imino]azanium is sourced from PubChem (CID 6333298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).