About [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol
[3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol (PubChem CID 63333605) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol |
| PubChem CID | 63333605 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol |
| SMILES | OCC1(N2CCCNCC2)CCOC1 |
| InChI | InChI=1S/C10H20N2O2/c13-8-10(2-7-14-9-10)12-5-1-3-11-4-6-12/h11,13H,1-9H2 |
| InChIKey | HVYJFRKSWYJYST-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol?
The IUPAC name of [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol (CID 63333605) is [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol.
What is the SMILES notation for [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol?
The canonical SMILES for [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol is OCC1(N2CCCNCC2)CCOC1.
What is the InChIKey of [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol?
The InChIKey is HVYJFRKSWYJYST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c13-8-10(2-7-14-9-10)12-5-1-3-11-4-6-12/h11,13H,1-9H2.
What are the key properties of [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol?
[3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol has a molecular weight of 200.28 g/mol, XLogP of -0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,4-diazepan-1-yl)oxolan-3-yl]methanol is sourced from PubChem (CID 63333605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).