About bromonickel;2-methanidylprop-1-ene;triphenylphosphanium
bromonickel;2-methanidylprop-1-ene;triphenylphosphanium (PubChem CID 6333462) has the molecular formula C22H22BrNiP-
and a molecular weight of 455.99 g/mol. Its IUPAC name is bromonickel;2-methanidylprop-1-ene;triphenylphosphanium.
Molecular Properties
| Compound Name | bromonickel;2-methanidylprop-1-ene;triphenylphosphanium |
| PubChem CID | 6333462 |
| Molecular Formula | C22H22BrNiP- |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | bromonickel;2-methanidylprop-1-ene;triphenylphosphanium |
| SMILES | [H]/[C-]=C(/[CH2-])C.[Ni]Br.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C4H6.BrH.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(2)3;;/h1-15H;1H,2H2,3H3;1H;/q;-2;;+1 |
| InChIKey | AJDCQLAEWGKSCA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromonickel;2-methanidylprop-1-ene;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromonickel;2-methanidylprop-1-ene;triphenylphosphanium?
The IUPAC name of bromonickel;2-methanidylprop-1-ene;triphenylphosphanium (CID 6333462) is bromonickel;2-methanidylprop-1-ene;triphenylphosphanium.
What is the SMILES notation for bromonickel;2-methanidylprop-1-ene;triphenylphosphanium?
The canonical SMILES for bromonickel;2-methanidylprop-1-ene;triphenylphosphanium is [H]/[C-]=C(/[CH2-])C.[Ni]Br.c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bromonickel;2-methanidylprop-1-ene;triphenylphosphanium?
The InChIKey is AJDCQLAEWGKSCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C4H6.BrH.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4(2)3;;/h1-15H;1H,2H2,3H3;1H;/q;-2;;+1.
What are the key properties of bromonickel;2-methanidylprop-1-ene;triphenylphosphanium?
bromonickel;2-methanidylprop-1-ene;triphenylphosphanium has a molecular weight of 455.99 g/mol, XLogP of 5.22, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromonickel;2-methanidylprop-1-ene;triphenylphosphanium is sourced from PubChem (CID 6333462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).