C10H13BrN2O — CID 63334898
2-amino-N-(3-bromo-4-methylphenyl)propanamide (PubChem CID 63334898) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-amino-N-(3-bromo-4-methylphenyl)propanamide.
| Compound Name | 2-amino-N-(3-bromo-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 63334898 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-amino-N-(3-bromo-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)C(C)N)cc1Br |
| InChI | InChI=1S/C10H13BrN2O/c1-6-3-4-8(5-9(6)11)13-10(14)7(2)12/h3-5,7H,12H2,1-2H3,(H,13,14) |
| InChIKey | NQGFDCGJOUKVJW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |