About 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine
5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 63334948) has the molecular formula C11H11BrN2S
and a molecular weight of 283.19 g/mol. Its IUPAC name is 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 63334948 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Cc2cnc(N)s2)cc1Br |
| InChI | InChI=1S/C11H11BrN2S/c1-7-2-3-8(5-10(7)12)4-9-6-14-11(13)15-9/h2-3,5-6H,4H2,1H3,(H2,13,14) |
| InChIKey | SYNMKFCMKNGZCZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine?
The IUPAC name of 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine (CID 63334948) is 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine is Cc1ccc(Cc2cnc(N)s2)cc1Br.
What is the InChIKey of 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine?
The InChIKey is SYNMKFCMKNGZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2S/c1-7-2-3-8(5-10(7)12)4-9-6-14-11(13)15-9/h2-3,5-6H,4H2,1H3,(H2,13,14).
What are the key properties of 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine?
5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine has a molecular weight of 283.19 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-bromo-4-methylphenyl)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 63334948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).