C30H57N3O3 — CID 633352
2,4,6-tris(3,5,5-trimethylhexoxy)-1,3,5-triazine (PubChem CID 633352) has the molecular formula C30H57N3O3 and a molecular weight of 507.80 g/mol. Its IUPAC name is 2,4,6-tris(3,5,5-trimethylhexoxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(3,5,5-trimethylhexoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 633352 |
| Molecular Formula | C30H57N3O3 |
| Molecular Weight | 507.80 g/mol |
| Exact Mass | 507.44 |
| IUPAC Name | 2,4,6-tris(3,5,5-trimethylhexoxy)-1,3,5-triazine |
| SMILES | CC(CCOc1nc(OCCC(C)CC(C)(C)C)nc(OCCC(C)CC(C)(C)C)n1)CC(C)(C)C |
| InChI | InChI=1S/C30H57N3O3/c1-22(19-28(4,5)6)13-16-34-25-31-26(35-17-14-23(2)20-29(7,8)9)33-27(32-25)36-18-15-24(3)21-30(10,11)12/h22-24H,13-21H2,1-12H3 |
| InChIKey | XZQWNDCCPBVCRT-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.80 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |