C12H22N2O2 — CID 63335447
[3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)oxolan-3-yl]methanamine (PubChem CID 63335447) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is [3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)oxolan-3-yl]methanamine.
| Compound Name | [3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)oxolan-3-yl]methanamine |
|---|---|
| PubChem CID | 63335447 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | [3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)oxolan-3-yl]methanamine |
| SMILES | NCC1(N2CCOC3CCCC32)CCOC1 |
| InChI | InChI=1S/C12H22N2O2/c13-8-12(4-6-15-9-12)14-5-7-16-11-3-1-2-10(11)14/h10-11H,1-9,13H2 |
| InChIKey | IWRBZOUQPVBFFQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |