C10H10F3NO — CID 63335709
N-(3,4,5-trifluorophenyl)oxolan-3-amine (PubChem CID 63335709) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is N-(3,4,5-trifluorophenyl)oxolan-3-amine.
| Compound Name | N-(3,4,5-trifluorophenyl)oxolan-3-amine |
|---|---|
| PubChem CID | 63335709 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-(3,4,5-trifluorophenyl)oxolan-3-amine |
| SMILES | Fc1cc(NC2CCOC2)cc(F)c1F |
| InChI | InChI=1S/C10H10F3NO/c11-8-3-7(4-9(12)10(8)13)14-6-1-2-15-5-6/h3-4,6,14H,1-2,5H2 |
| InChIKey | CUADBOPCUHTHCS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|