About Stannane, chlorohydroxydiphenyl-
Stannane, chlorohydroxydiphenyl- (PubChem CID 6333579) has the molecular formula C12H12ClOSn
and a molecular weight of 326.39 g/mol.
Molecular Properties
| Compound Name | Stannane, chlorohydroxydiphenyl- |
| PubChem CID | 6333579 |
| Molecular Formula | C12H12ClOSn |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | — |
| SMILES | Cl[Sn](c1ccccc1)c1ccccc1.O |
| InChI | InChI=1S/2C6H5.ClH.H2O.Sn/c2*1-2-4-6-5-3-1;;;/h2*1-5H;1H;1H2;/q;;;;+1/p-1 |
| InChIKey | KRJAJGBJNNVEAP-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Stannane, chlorohydroxydiphenyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Stannane, chlorohydroxydiphenyl-?
The IUPAC name of Stannane, chlorohydroxydiphenyl- (CID 6333579) is not available.
What is the SMILES notation for Stannane, chlorohydroxydiphenyl-?
The canonical SMILES for Stannane, chlorohydroxydiphenyl- is Cl[Sn](c1ccccc1)c1ccccc1.O.
What is the InChIKey of Stannane, chlorohydroxydiphenyl-?
The InChIKey is KRJAJGBJNNVEAP-UHFFFAOYSA-M. The full InChI is InChI=1S/2C6H5.ClH.H2O.Sn/c2*1-2-4-6-5-3-1;;;/h2*1-5H;1H;1H2;/q;;;;+1/p-1.
What are the key properties of Stannane, chlorohydroxydiphenyl-?
Stannane, chlorohydroxydiphenyl- has a molecular weight of 326.39 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Stannane, chlorohydroxydiphenyl- is sourced from PubChem (CID 6333579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).