About acetic acid;gold;triphenylphosphanium
acetic acid;gold;triphenylphosphanium (PubChem CID 6333605) has the molecular formula C20H20AuO2P+
and a molecular weight of 520.32 g/mol. Its IUPAC name is acetic acid;gold;triphenylphosphanium.
Molecular Properties
| Compound Name | acetic acid;gold;triphenylphosphanium |
| PubChem CID | 6333605 |
| Molecular Formula | C20H20AuO2P+ |
| Molecular Weight | 520.32 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | acetic acid;gold;triphenylphosphanium |
| SMILES | CC(=O)O.[Au].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C2H4O2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2(3)4;/h1-15H;1H3,(H,3,4);/p+1 |
| InChIKey | NUTGXZNAEWIDCP-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 520.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;gold;triphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;gold;triphenylphosphanium?
The IUPAC name of acetic acid;gold;triphenylphosphanium (CID 6333605) is acetic acid;gold;triphenylphosphanium.
What is the SMILES notation for acetic acid;gold;triphenylphosphanium?
The canonical SMILES for acetic acid;gold;triphenylphosphanium is CC(=O)O.[Au].c1ccc([PH+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of acetic acid;gold;triphenylphosphanium?
The InChIKey is NUTGXZNAEWIDCP-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15P.C2H4O2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2(3)4;/h1-15H;1H3,(H,3,4);/p+1.
What are the key properties of acetic acid;gold;triphenylphosphanium?
acetic acid;gold;triphenylphosphanium has a molecular weight of 520.32 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;gold;triphenylphosphanium is sourced from PubChem (CID 6333605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).