C9H9F3O4S — CID 63336275
3-[2-(2,2,2-trifluoroethoxy)ethoxy]thiophene-2-carboxylic acid (PubChem CID 63336275) has the molecular formula C9H9F3O4S and a molecular weight of 270.23 g/mol. Its IUPAC name is 3-[2-(2,2,2-trifluoroethoxy)ethoxy]thiophene-2-carboxylic acid.
| Compound Name | 3-[2-(2,2,2-trifluoroethoxy)ethoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63336275 |
| Molecular Formula | C9H9F3O4S |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 3-[2-(2,2,2-trifluoroethoxy)ethoxy]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C9H9F3O4S/c10-9(11,12)5-15-2-3-16-6-1-4-17-7(6)8(13)14/h1,4H,2-3,5H2,(H,13,14) |
| InChIKey | YHSUURMUDHVMKX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|