C39H60N6O15 — CID 6333736
N-[(9Z,21Z,33Z)-15,27-diacetamido-7,19,31-trihydroxy-10,22,34-trimethyl-2,8,14,20,26,32-hexaoxo-1,13,25-trioxa-7,19,31-triazacyclohexatriaconta-9,21,33-trien-3-yl]acetamide (PubChem CID 6333736) has the molecular formula C39H60N6O15 and a molecular weight of 852.94 g/mol. Its IUPAC name is N-[(9Z,21Z,33Z)-15,27-diacetamido-7,19,31-trihydroxy-10,22,34-trimethyl-2,8,14,20,26,32-hexaoxo-1,13,25-trioxa-7,19,31-triazacyclohexatriaconta-9,21,33-trien-3-yl]acetamide.
| Compound Name | N-[(9Z,21Z,33Z)-15,27-diacetamido-7,19,31-trihydroxy-10,22,34-trimethyl-2,8,14,20,26,32-hexaoxo-1,13,25-trioxa-7,19,31-triazacyclohexatriaconta-9,21,33-trien-3-yl]acetamide |
|---|---|
| PubChem CID | 6333736 |
| Molecular Formula | C39H60N6O15 |
| Molecular Weight | 852.94 g/mol |
| Exact Mass | 852.41 |
| IUPAC Name | N-[(9Z,21Z,33Z)-15,27-diacetamido-7,19,31-trihydroxy-10,22,34-trimethyl-2,8,14,20,26,32-hexaoxo-1,13,25-trioxa-7,19,31-triazacyclohexatriaconta-9,21,33-trien-3-yl]acetamide |
| SMILES | CC(=O)NC1CCCN(O)C(=O)/C=C(/C)CCOC(=O)C(NC(C)=O)CCCN(O)C(=O)/C=C(/C)CCOC(=O)C(NC(C)=O)CCCN(O)C(=O)/C=C(/C)CCOC1=O |
| InChI | InChI=1S/C39H60N6O15/c1-25-13-19-58-37(52)31(40-28(4)46)11-8-17-44(56)35(50)23-27(3)15-21-60-39(54)33(42-30(6)48)12-9-18-45(57)36(51)24-26(2)14-20-59-38(53)32(41-29(5)47)10-7-16-43(55)34(49)22-25/h22-24,31-33,55-57H,7-21H2,1-6H3,(H,40,46)(H,41,47)(H,42,48)/b25-22-,26-24-,27-23- |
| InChIKey | VGXYDZCCQDSGLZ-QVPILNJQSA-N |
| XLogP | 1.15 |
| TPSA | 287.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.94 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|