C11H20N4O — CID 63337622
3-[4-(cyanomethyl)piperazin-1-yl]-N,N-dimethylpropanamide (PubChem CID 63337622) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-[4-(cyanomethyl)piperazin-1-yl]-N,N-dimethylpropanamide.
| Compound Name | 3-[4-(cyanomethyl)piperazin-1-yl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 63337622 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-[4-(cyanomethyl)piperazin-1-yl]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCN1CCN(CC#N)CC1 |
| InChI | InChI=1S/C11H20N4O/c1-13(2)11(16)3-5-14-7-9-15(6-4-12)10-8-14/h3,5-10H2,1-2H3 |
| InChIKey | UTRLWWHUDMSELG-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|