C14H19N3OS — CID 63337816
2-[4-(2-thiophen-3-ylacetyl)piperazin-1-yl]butanenitrile (PubChem CID 63337816) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[4-(2-thiophen-3-ylacetyl)piperazin-1-yl]butanenitrile.
| Compound Name | 2-[4-(2-thiophen-3-ylacetyl)piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 63337816 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[4-(2-thiophen-3-ylacetyl)piperazin-1-yl]butanenitrile |
| SMILES | CCC(C#N)N1CCN(C(=O)Cc2ccsc2)CC1 |
| InChI | InChI=1S/C14H19N3OS/c1-2-13(10-15)16-4-6-17(7-5-16)14(18)9-12-3-8-19-11-12/h3,8,11,13H,2,4-7,9H2,1H3 |
| InChIKey | YHUAFNHLAUGTST-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |