About 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide
4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide (PubChem CID 63338474) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide |
| PubChem CID | 63338474 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCn1cc(-c2ccccc2N)cn1 |
| InChI | InChI=1S/C15H20N4O/c1-18(2)15(20)8-5-9-19-11-12(10-17-19)13-6-3-4-7-14(13)16/h3-4,6-7,10-11H,5,8-9,16H2,1-2H3 |
| InChIKey | LPCCWYFGRVYSSB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide?
The IUPAC name of 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide (CID 63338474) is 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide.
What is the SMILES notation for 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide?
The canonical SMILES for 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide is CN(C)C(=O)CCCn1cc(-c2ccccc2N)cn1.
What is the InChIKey of 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide?
The InChIKey is LPCCWYFGRVYSSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O/c1-18(2)15(20)8-5-9-19-11-12(10-17-19)13-6-3-4-7-14(13)16/h3-4,6-7,10-11H,5,8-9,16H2,1-2H3.
What are the key properties of 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide?
4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide has a molecular weight of 272.35 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-aminophenyl)pyrazol-1-yl]-N,N-dimethylbutanamide is sourced from PubChem (CID 63338474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).