About 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile
2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile (PubChem CID 63339027) has the molecular formula C11H19N3O3S
and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile.
Molecular Properties
| Compound Name | 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile |
| PubChem CID | 63339027 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile |
| SMILES | CC(C#N)N1CCN(C2CS(=O)(=O)CC2O)CC1 |
| InChI | InChI=1S/C11H19N3O3S/c1-9(6-12)13-2-4-14(5-3-13)10-7-18(16,17)8-11(10)15/h9-11,15H,2-5,7-8H2,1H3 |
| InChIKey | RNTMTGORJDEXSP-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile?
The IUPAC name of 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile (CID 63339027) is 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile.
What is the SMILES notation for 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile?
The canonical SMILES for 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile is CC(C#N)N1CCN(C2CS(=O)(=O)CC2O)CC1.
What is the InChIKey of 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile?
The InChIKey is RNTMTGORJDEXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3S/c1-9(6-12)13-2-4-14(5-3-13)10-7-18(16,17)8-11(10)15/h9-11,15H,2-5,7-8H2,1H3.
What are the key properties of 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile?
2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile has a molecular weight of 273.36 g/mol, XLogP of -1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-hydroxy-1,1-dioxothiolan-3-yl)piperazin-1-yl]propanenitrile is sourced from PubChem (CID 63339027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).