C16H23N3OS — CID 63339852
2-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]propanethioamide (PubChem CID 63339852) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 2-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]propanethioamide.
| Compound Name | 2-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 63339852 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[4-[2-(2-methylphenyl)acetyl]piperazin-1-yl]propanethioamide |
| SMILES | Cc1ccccc1CC(=O)N1CCN(C(C)C(N)=S)CC1 |
| InChI | InChI=1S/C16H23N3OS/c1-12-5-3-4-6-14(12)11-15(20)19-9-7-18(8-10-19)13(2)16(17)21/h3-6,13H,7-11H2,1-2H3,(H2,17,21) |
| InChIKey | PWLNNCTWBIXIMF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|