C7H15Cl5N2O2PSb — CID 6333990
N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;trichlorostibane (PubChem CID 6333990) has the molecular formula C7H15Cl5N2O2PSb and a molecular weight of 489.21 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;trichlorostibane.
| Compound Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;trichlorostibane |
|---|---|
| PubChem CID | 6333990 |
| Molecular Formula | C7H15Cl5N2O2PSb |
| Molecular Weight | 489.21 g/mol |
| Exact Mass | 485.84 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;trichlorostibane |
| SMILES | Cl[Sb](Cl)Cl.O=P1(N(CCCl)CCCl)NCCCO1 |
| InChI | InChI=1S/C7H15Cl2N2O2P.3ClH.Sb/c8-2-5-11(6-3-9)14(12)10-4-1-7-13-14;;;;/h1-7H2,(H,10,12);3*1H;/q;;;;+3/p-3 |
| InChIKey | PFNADNNYKZQURH-UHFFFAOYSA-K |
| XLogP | 3.57 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|