About 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide
2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide (PubChem CID 63341722) has the molecular formula C13H25N3O2S2
and a molecular weight of 319.50 g/mol. Its IUPAC name is 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide.
Molecular Properties
| Compound Name | 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide |
| PubChem CID | 63341722 |
| Molecular Formula | C13H25N3O2S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide |
| SMILES | CCCC(C(N)=S)N1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H25N3O2S2/c1-2-3-12(13(14)19)16-7-5-15(6-8-16)11-4-9-20(17,18)10-11/h11-12H,2-10H2,1H3,(H2,14,19) |
| InChIKey | KLECSUDKAJMHJX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide?
The IUPAC name of 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide (CID 63341722) is 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide.
What is the SMILES notation for 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide?
The canonical SMILES for 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide is CCCC(C(N)=S)N1CCN(C2CCS(=O)(=O)C2)CC1.
What is the InChIKey of 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide?
The InChIKey is KLECSUDKAJMHJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O2S2/c1-2-3-12(13(14)19)16-7-5-15(6-8-16)11-4-9-20(17,18)10-11/h11-12H,2-10H2,1H3,(H2,14,19).
What are the key properties of 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide?
2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide has a molecular weight of 319.50 g/mol, XLogP of 0.25, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]pentanethioamide is sourced from PubChem (CID 63341722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).