About 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide
4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide (PubChem CID 63342444) has the molecular formula C14H28N4OS
and a molecular weight of 300.47 g/mol. Its IUPAC name is 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide |
| PubChem CID | 63342444 |
| Molecular Formula | C14H28N4OS |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCN1CCN(C(C)(C)C(N)=S)CC1 |
| InChI | InChI=1S/C14H28N4OS/c1-14(2,13(15)20)18-10-8-17(9-11-18)7-5-6-12(19)16(3)4/h5-11H2,1-4H3,(H2,15,20) |
| InChIKey | USXVALGZXKEOEN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide?
The IUPAC name of 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide (CID 63342444) is 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide.
What is the SMILES notation for 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide?
The canonical SMILES for 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide is CN(C)C(=O)CCCN1CCN(C(C)(C)C(N)=S)CC1.
What is the InChIKey of 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide?
The InChIKey is USXVALGZXKEOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4OS/c1-14(2,13(15)20)18-10-8-17(9-11-18)7-5-6-12(19)16(3)4/h5-11H2,1-4H3,(H2,15,20).
What are the key properties of 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide?
4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide has a molecular weight of 300.47 g/mol, XLogP of 0.54, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1-amino-2-methyl-1-sulfanylidenepropan-2-yl)piperazin-1-yl]-N,N-dimethylbutanamide is sourced from PubChem (CID 63342444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).