C13H18BrN3OS2 — CID 63343775
2-[4-(5-bromothiophene-2-carbonyl)piperazin-1-yl]-2-methylpropanethioamide (PubChem CID 63343775) has the molecular formula C13H18BrN3OS2 and a molecular weight of 376.35 g/mol. Its IUPAC name is 2-[4-(5-bromothiophene-2-carbonyl)piperazin-1-yl]-2-methylpropanethioamide.
| Compound Name | 2-[4-(5-bromothiophene-2-carbonyl)piperazin-1-yl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 63343775 |
| Molecular Formula | C13H18BrN3OS2 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-[4-(5-bromothiophene-2-carbonyl)piperazin-1-yl]-2-methylpropanethioamide |
| SMILES | CC(C)(C(N)=S)N1CCN(C(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C13H18BrN3OS2/c1-13(2,12(15)19)17-7-5-16(6-8-17)11(18)9-3-4-10(14)20-9/h3-4H,5-8H2,1-2H3,(H2,15,19) |
| InChIKey | UTNGPDWWKITLRW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|