C14H17FN2O2 — CID 63346122
3-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]pentan-2-ol (PubChem CID 63346122) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]pentan-2-ol.
| Compound Name | 3-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]pentan-2-ol |
|---|---|
| PubChem CID | 63346122 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]pentan-2-ol |
| SMILES | CCC(c1nc(Cc2ccc(F)cc2)no1)C(C)O |
| InChI | InChI=1S/C14H17FN2O2/c1-3-12(9(2)18)14-16-13(17-19-14)8-10-4-6-11(15)7-5-10/h4-7,9,12,18H,3,8H2,1-2H3 |
| InChIKey | UQFXSWHIYSFSFA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |