About 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol
4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol (PubChem CID 63346307) has the molecular formula C17H13NO2S
and a molecular weight of 295.36 g/mol. Its IUPAC name is 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol.
Molecular Properties
| Compound Name | 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol |
| PubChem CID | 63346307 |
| Molecular Formula | C17H13NO2S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol |
| SMILES | OC(c1ccccc1)c1nc2c(s1)COc1ccccc1-2 |
| InChI | InChI=1S/C17H13NO2S/c19-16(11-6-2-1-3-7-11)17-18-15-12-8-4-5-9-13(12)20-10-14(15)21-17/h1-9,16,19H,10H2 |
| InChIKey | HVJCZOJXOMSRAF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol?
The IUPAC name of 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol (CID 63346307) is 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol.
What is the SMILES notation for 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol?
The canonical SMILES for 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol is OC(c1ccccc1)c1nc2c(s1)COc1ccccc1-2.
What is the InChIKey of 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol?
The InChIKey is HVJCZOJXOMSRAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2S/c19-16(11-6-2-1-3-7-11)17-18-15-12-8-4-5-9-13(12)20-10-14(15)21-17/h1-9,16,19H,10H2.
What are the key properties of 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol?
4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol has a molecular weight of 295.36 g/mol, XLogP of 3.78, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-chromeno[4,3-d][1,3]thiazol-2-yl(phenyl)methanol is sourced from PubChem (CID 63346307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).