C11H14N4O — CID 63347367
4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)butan-2-amine (PubChem CID 63347367) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)butan-2-amine.
| Compound Name | 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 63347367 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)butan-2-amine |
| SMILES | CC(N)CCc1nc(-c2ccncc2)no1 |
| InChI | InChI=1S/C11H14N4O/c1-8(12)2-3-10-14-11(15-16-10)9-4-6-13-7-5-9/h4-8H,2-3,12H2,1H3 |
| InChIKey | JKZJGNFAKTZINO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |