C11H21N3O — CID 63348667
N-ethyl-3-(3-propyl-1,2,4-oxadiazol-5-yl)butan-2-amine (PubChem CID 63348667) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N-ethyl-3-(3-propyl-1,2,4-oxadiazol-5-yl)butan-2-amine.
| Compound Name | N-ethyl-3-(3-propyl-1,2,4-oxadiazol-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 63348667 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-ethyl-3-(3-propyl-1,2,4-oxadiazol-5-yl)butan-2-amine |
| SMILES | CCCc1noc(C(C)C(C)NCC)n1 |
| InChI | InChI=1S/C11H21N3O/c1-5-7-10-13-11(15-14-10)8(3)9(4)12-6-2/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | KFSWXCIXTNIEAB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |