C11H10Cl2N2O2 — CID 63349689
1-[3-[(3,4-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 63349689) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is 1-[3-[(3,4-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | 1-[3-[(3,4-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 63349689 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 1-[3-[(3,4-dichlorophenyl)methyl]-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | CC(O)c1nc(Cc2ccc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C11H10Cl2N2O2/c1-6(16)11-14-10(15-17-11)5-7-2-3-8(12)9(13)4-7/h2-4,6,16H,5H2,1H3 |
| InChIKey | PSXSLJTXCNEFGZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |