C9H14F2N2O3 — CID 63349696
1,1-difluoro-3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]propan-2-ol (PubChem CID 63349696) has the molecular formula C9H14F2N2O3 and a molecular weight of 236.22 g/mol. Its IUPAC name is 1,1-difluoro-3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 63349696 |
| Molecular Formula | C9H14F2N2O3 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1,1-difluoro-3-[3-(propoxymethyl)-1,2,4-oxadiazol-5-yl]propan-2-ol |
| SMILES | CCCOCc1noc(CC(O)C(F)F)n1 |
| InChI | InChI=1S/C9H14F2N2O3/c1-2-3-15-5-7-12-8(16-13-7)4-6(14)9(10)11/h6,9,14H,2-5H2,1H3 |
| InChIKey | JXJAFDYSDHQQKJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|