C16H19FN4 — CID 63351433
[2-[(2-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine (PubChem CID 63351433) has the molecular formula C16H19FN4 and a molecular weight of 286.35 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-[(2-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63351433 |
| Molecular Formula | C16H19FN4 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [2-[(2-fluorophenyl)methyl]-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(Cc2ccccc2F)nc2c1CCCCC2 |
| InChI | InChI=1S/C16H19FN4/c17-13-8-5-4-6-11(13)10-15-19-14-9-3-1-2-7-12(14)16(20-15)21-18/h4-6,8H,1-3,7,9-10,18H2,(H,19,20,21) |
| InChIKey | HLEZMWCOKGOVNR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|