C16H20N2O — CID 63351532
4-ethoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine (PubChem CID 63351532) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-ethoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine.
| Compound Name | 4-ethoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine |
|---|---|
| PubChem CID | 63351532 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-ethoxy-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine |
| SMILES | CCOc1cccc2c(N)c3c(nc12)CCCCC3 |
| InChI | InChI=1S/C16H20N2O/c1-2-19-14-10-6-8-12-15(17)11-7-4-3-5-9-13(11)18-16(12)14/h6,8,10H,2-5,7,9H2,1H3,(H2,17,18) |
| InChIKey | HUFBFARCTVCMLR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |