C14H13F3N2 — CID 63351534
1,2,4-trifluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine (PubChem CID 63351534) has the molecular formula C14H13F3N2 and a molecular weight of 266.27 g/mol. Its IUPAC name is 1,2,4-trifluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine.
| Compound Name | 1,2,4-trifluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine |
|---|---|
| PubChem CID | 63351534 |
| Molecular Formula | C14H13F3N2 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 1,2,4-trifluoro-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-amine |
| SMILES | Nc1c2c(nc3c(F)cc(F)c(F)c13)CCCCC2 |
| InChI | InChI=1S/C14H13F3N2/c15-8-6-9(16)14-11(12(8)17)13(18)7-4-2-1-3-5-10(7)19-14/h6H,1-5H2,(H2,18,19) |
| InChIKey | JGLMYCDQIOSDFB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|